C22H18N6O8S — CID 67468202
4-[[4-(4-carboxyanilino)-6-sulfooxy-1,3,5-triazin-2-yl]amino]benzoic acid;pyridine (PubChem CID 67468202) has the molecular formula C22H18N6O8S and a molecular weight of 526.49 g/mol. Its IUPAC name is 4-[[4-(4-carboxyanilino)-6-sulfooxy-1,3,5-triazin-2-yl]amino]benzoic acid;pyridine.
| Compound Name | 4-[[4-(4-carboxyanilino)-6-sulfooxy-1,3,5-triazin-2-yl]amino]benzoic acid;pyridine |
|---|---|
| PubChem CID | 67468202 |
| Molecular Formula | C22H18N6O8S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 4-[[4-(4-carboxyanilino)-6-sulfooxy-1,3,5-triazin-2-yl]amino]benzoic acid;pyridine |
| SMILES | O=C(O)c1ccc(Nc2nc(Nc3ccc(C(=O)O)cc3)nc(OS(=O)(=O)O)n2)cc1.c1ccncc1 |
| InChI | InChI=1S/C17H13N5O8S.C5H5N/c23-13(24)9-1-5-11(6-2-9)18-15-20-16(22-17(21-15)30-31(27,28)29)19-12-7-3-10(4-8-12)14(25)26;1-2-4-6-5-3-1/h1-8H,(H,23,24)(H,25,26)(H,27,28,29)(H2,18,19,20,21,22);1-5H |
| InChIKey | GROYQACSCYNDQG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 213.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|