C21H27ClN6O3S — CID 87210983
tert-butyl 5-[(5-chloro-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 87210983) has the molecular formula C21H27ClN6O3S and a molecular weight of 479.01 g/mol. Its IUPAC name is tert-butyl 5-[(5-chloro-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[(5-chloro-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 87210983 |
| Molecular Formula | C21H27ClN6O3S |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | tert-butyl 5-[(5-chloro-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2=CN(Cc3nc4c(N5CCOCC5)nc(Cl)nc4s3)CC2C1 |
| InChI | InChI=1S/C21H27ClN6O3S/c1-21(2,3)31-20(29)28-10-13-8-26(9-14(13)11-28)12-15-23-16-17(27-4-6-30-7-5-27)24-19(22)25-18(16)32-15/h8,14H,4-7,9-12H2,1-3H3 |
| InChIKey | IEIVHWNHSNXZOI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |