C27H28N4O3S — CID 68773931
tert-butyl 5-[[6-(1,3-benzothiazol-2-yloxy)-1H-indol-3-yl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 68773931) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is tert-butyl 5-[[6-(1,3-benzothiazol-2-yloxy)-1H-indol-3-yl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[[6-(1,3-benzothiazol-2-yloxy)-1H-indol-3-yl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 68773931 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | tert-butyl 5-[[6-(1,3-benzothiazol-2-yloxy)-1H-indol-3-yl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2=CN(Cc3c[nH]c4cc(Oc5nc6ccccc6s5)ccc34)CC2C1 |
| InChI | InChI=1S/C27H28N4O3S/c1-27(2,3)34-26(32)31-15-18-13-30(14-19(18)16-31)12-17-11-28-23-10-20(8-9-21(17)23)33-25-29-22-6-4-5-7-24(22)35-25/h4-11,13,19,28H,12,14-16H2,1-3H3 |
| InChIKey | QOUPKKIPTJCJHB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |