C22H22N4O2S — CID 67208004
5-[[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide (PubChem CID 67208004) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 5-[[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide.
| Compound Name | 5-[[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 67208004 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 5-[[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]methyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
| SMILES | Cc1ccc2nc(Oc3ccc(CN4C=C5CN(C(N)=O)CC5C4)cc3)sc2c1 |
| InChI | InChI=1S/C22H22N4O2S/c1-14-2-7-19-20(8-14)29-22(24-19)28-18-5-3-15(4-6-18)9-25-10-16-12-26(21(23)27)13-17(16)11-25/h2-8,10,17H,9,11-13H2,1H3,(H2,23,27) |
| InChIKey | WXDPGLXUISBKMV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |