C24H27N3O2S — CID 42597659
1-[2-[2-[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone (PubChem CID 42597659) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-[2-[2-[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone.
| Compound Name | 1-[2-[2-[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 42597659 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[2-[2-[4-[(6-methyl-1,3-benzothiazol-2-yl)oxy]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
| SMILES | CC(=O)N1CC2CN(CCc3ccc(Oc4nc5ccc(C)cc5s4)cc3)CC2C1 |
| InChI | InChI=1S/C24H27N3O2S/c1-16-3-8-22-23(11-16)30-24(25-22)29-21-6-4-18(5-7-21)9-10-26-12-19-14-27(17(2)28)15-20(19)13-26/h3-8,11,19-20H,9-10,12-15H2,1-2H3 |
| InChIKey | AWHBELTZDNUVSY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |