C28H32ClF2N3O4 — CID 87211219
(E)-1-[(3R,4S)-4-[(1R)-2-(6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-1-hydroxyethyl]-3,4-dihydroxypiperidin-1-yl]-3-(3,5-difluorophenyl)prop-2-en-1-one (PubChem CID 87211219) has the molecular formula C28H32ClF2N3O4 and a molecular weight of 548.03 g/mol. Its IUPAC name is (E)-1-[(3R,4S)-4-[(1R)-2-(6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-1-hydroxyethyl]-3,4-dihydroxypiperidin-1-yl]-3-(3,5-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3R,4S)-4-[(1R)-2-(6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-1-hydroxyethyl]-3,4-dihydroxypiperidin-1-yl]-3-(3,5-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87211219 |
| Molecular Formula | C28H32ClF2N3O4 |
| Molecular Weight | 548.03 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (E)-1-[(3R,4S)-4-[(1R)-2-(6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-1-hydroxyethyl]-3,4-dihydroxypiperidin-1-yl]-3-(3,5-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(F)cc(F)c1)N1CC[C@](O)([C@H](O)CN2CCC3(CC2)CNc2cc(Cl)ccc23)[C@H](O)C1 |
| InChI | InChI=1S/C28H32ClF2N3O4/c29-19-2-3-22-23(13-19)32-17-27(22)5-8-33(9-6-27)15-24(35)28(38)7-10-34(16-25(28)36)26(37)4-1-18-11-20(30)14-21(31)12-18/h1-4,11-14,24-25,32,35-36,38H,5-10,15-17H2/b4-1+/t24-,25-,28+/m1/s1 |
| InChIKey | IWXFYTKSBKFXLE-FISHPLGXSA-N |
| XLogP | 2.78 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.03 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|