About [cyano(phenyl)methoxy] methanesulfonate
[cyano(phenyl)methoxy] methanesulfonate (PubChem CID 87211740) has the molecular formula C9H9NO4S
and a molecular weight of 227.24 g/mol. Its IUPAC name is [cyano(phenyl)methoxy] methanesulfonate.
Molecular Properties
| Compound Name | [cyano(phenyl)methoxy] methanesulfonate |
| PubChem CID | 87211740 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [cyano(phenyl)methoxy] methanesulfonate |
| SMILES | CS(=O)(=O)OOC(C#N)c1ccccc1 |
| InChI | InChI=1S/C9H9NO4S/c1-15(11,12)14-13-9(7-10)8-5-3-2-4-6-8/h2-6,9H,1H3 |
| InChIKey | NACHRYVJICOUAN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [cyano(phenyl)methoxy] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano(phenyl)methoxy] methanesulfonate?
The IUPAC name of [cyano(phenyl)methoxy] methanesulfonate (CID 87211740) is [cyano(phenyl)methoxy] methanesulfonate.
What is the SMILES notation for [cyano(phenyl)methoxy] methanesulfonate?
The canonical SMILES for [cyano(phenyl)methoxy] methanesulfonate is CS(=O)(=O)OOC(C#N)c1ccccc1.
What is the InChIKey of [cyano(phenyl)methoxy] methanesulfonate?
The InChIKey is NACHRYVJICOUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4S/c1-15(11,12)14-13-9(7-10)8-5-3-2-4-6-8/h2-6,9H,1H3.
What are the key properties of [cyano(phenyl)methoxy] methanesulfonate?
[cyano(phenyl)methoxy] methanesulfonate has a molecular weight of 227.24 g/mol, XLogP of 1.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano(phenyl)methoxy] methanesulfonate is sourced from PubChem (CID 87211740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).