About [(2R)-butan-2-yl] pentyl carbonate
[(2R)-butan-2-yl] pentyl carbonate (PubChem CID 87213019) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is [(2R)-butan-2-yl] pentyl carbonate.
Molecular Properties
| Compound Name | [(2R)-butan-2-yl] pentyl carbonate |
| PubChem CID | 87213019 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [(2R)-butan-2-yl] pentyl carbonate |
| SMILES | CCCCCOC(=O)O[C@H](C)CC |
| InChI | InChI=1S/C10H20O3/c1-4-6-7-8-12-10(11)13-9(3)5-2/h9H,4-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | NIMFLDSDAJBOSX-SECBINFHSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-butan-2-yl] pentyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-butan-2-yl] pentyl carbonate?
The IUPAC name of [(2R)-butan-2-yl] pentyl carbonate (CID 87213019) is [(2R)-butan-2-yl] pentyl carbonate.
What is the SMILES notation for [(2R)-butan-2-yl] pentyl carbonate?
The canonical SMILES for [(2R)-butan-2-yl] pentyl carbonate is CCCCCOC(=O)O[C@H](C)CC.
What is the InChIKey of [(2R)-butan-2-yl] pentyl carbonate?
The InChIKey is NIMFLDSDAJBOSX-SECBINFHSA-N. The full InChI is InChI=1S/C10H20O3/c1-4-6-7-8-12-10(11)13-9(3)5-2/h9H,4-8H2,1-3H3/t9-/m1/s1.
What are the key properties of [(2R)-butan-2-yl] pentyl carbonate?
[(2R)-butan-2-yl] pentyl carbonate has a molecular weight of 188.27 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-butan-2-yl] pentyl carbonate is sourced from PubChem (CID 87213019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).