About (1-iodo-2-methylpropyl) tridecyl carbonate
(1-iodo-2-methylpropyl) tridecyl carbonate (PubChem CID 172567594) has the molecular formula C18H35IO3
and a molecular weight of 426.38 g/mol. Its IUPAC name is (1-iodo-2-methylpropyl) tridecyl carbonate.
Molecular Properties
| Compound Name | (1-iodo-2-methylpropyl) tridecyl carbonate |
| PubChem CID | 172567594 |
| Molecular Formula | C18H35IO3 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (1-iodo-2-methylpropyl) tridecyl carbonate |
| SMILES | CCCCCCCCCCCCCOC(=O)OC(I)C(C)C |
| InChI | InChI=1S/C18H35IO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-21-18(20)22-17(19)16(2)3/h16-17H,4-15H2,1-3H3 |
| InChIKey | HDJIFMCHEXRNFL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1-iodo-2-methylpropyl) tridecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-iodo-2-methylpropyl) tridecyl carbonate?
The IUPAC name of (1-iodo-2-methylpropyl) tridecyl carbonate (CID 172567594) is (1-iodo-2-methylpropyl) tridecyl carbonate.
What is the SMILES notation for (1-iodo-2-methylpropyl) tridecyl carbonate?
The canonical SMILES for (1-iodo-2-methylpropyl) tridecyl carbonate is CCCCCCCCCCCCCOC(=O)OC(I)C(C)C.
What is the InChIKey of (1-iodo-2-methylpropyl) tridecyl carbonate?
The InChIKey is HDJIFMCHEXRNFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35IO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-21-18(20)22-17(19)16(2)3/h16-17H,4-15H2,1-3H3.
What are the key properties of (1-iodo-2-methylpropyl) tridecyl carbonate?
(1-iodo-2-methylpropyl) tridecyl carbonate has a molecular weight of 426.38 g/mol, XLogP of 6.87, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-iodo-2-methylpropyl) tridecyl carbonate is sourced from PubChem (CID 172567594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).