C38H36N8O8S2 — CID 87218051
bis[2-[[4-(furan-2-yl)-5-[methyl(2-pyridin-2-ylethyl)amino]-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 87218051) has the molecular formula C38H36N8O8S2 and a molecular weight of 796.89 g/mol. Its IUPAC name is bis[2-[[4-(furan-2-yl)-5-[methyl(2-pyridin-2-ylethyl)amino]-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | bis[2-[[4-(furan-2-yl)-5-[methyl(2-pyridin-2-ylethyl)amino]-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87218051 |
| Molecular Formula | C38H36N8O8S2 |
| Molecular Weight | 796.89 g/mol |
| Exact Mass | 796.21 |
| IUPAC Name | bis[2-[[4-(furan-2-yl)-5-[methyl(2-pyridin-2-ylethyl)amino]-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | CN(CCc1ccccn1)c1sc(NC(=O)COC(=O)/C=C/C(=O)OCC(=O)Nc2nc(-c3ccco3)c(N(C)CCc3ccccn3)s2)nc1-c1ccco1 |
| InChI | InChI=1S/C38H36N8O8S2/c1-45(19-15-25-9-3-5-17-39-25)35-33(27-11-7-21-51-27)43-37(55-35)41-29(47)23-53-31(49)13-14-32(50)54-24-30(48)42-38-44-34(28-12-8-22-52-28)36(56-38)46(2)20-16-26-10-4-6-18-40-26/h3-14,17-18,21-22H,15-16,19-20,23-24H2,1-2H3,(H,41,43,47)(H,42,44,48)/b14-13+ |
| InChIKey | YCGHKMPTCTXNJN-BUHFOSPRSA-N |
| XLogP | 5.49 |
| TPSA | 195.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|