C23H24N4O5S — CID 87223727
5-[[3-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxyphenyl]methylidene]-3-(2-oxopropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 87223727) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-[[3-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxyphenyl]methylidene]-3-(2-oxopropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxyphenyl]methylidene]-3-(2-oxopropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87223727 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 5-[[3-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxyphenyl]methylidene]-3-(2-oxopropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=O)CN1C(=O)SC(=Cc2cccc(Oc3ncnc(OC4CCNCC4)c3C)c2)C1=O |
| InChI | InChI=1S/C23H24N4O5S/c1-14(28)12-27-22(29)19(33-23(27)30)11-16-4-3-5-18(10-16)32-21-15(2)20(25-13-26-21)31-17-6-8-24-9-7-17/h3-5,10-11,13,17,24H,6-9,12H2,1-2H3 |
| InChIKey | ACHJNYRNOOGTMN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|