C15H13ClO2 — CID 87224592
bicyclo[3.1.0]hexa-1(6),2,4-triene;2-chloro-3-ethoxybenzaldehyde (PubChem CID 87224592) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;2-chloro-3-ethoxybenzaldehyde.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;2-chloro-3-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 87224592 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;2-chloro-3-ethoxybenzaldehyde |
| SMILES | CCOc1cccc(C=O)c1Cl.c1cc2cc-2c1 |
| InChI | InChI=1S/C9H9ClO2.C6H4/c1-2-12-8-5-3-4-7(6-11)9(8)10;1-2-5-4-6(5)3-1/h3-6H,2H2,1H3;1-4H |
| InChIKey | XQCKBJVSHFEQMA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|