About dimethyl(propyl)azanium;propane-1-sulfonate
dimethyl(propyl)azanium;propane-1-sulfonate (PubChem CID 87228092) has the molecular formula C8H21NO3S
and a molecular weight of 211.33 g/mol. Its IUPAC name is dimethyl(propyl)azanium;propane-1-sulfonate.
Molecular Properties
| Compound Name | dimethyl(propyl)azanium;propane-1-sulfonate |
| PubChem CID | 87228092 |
| Molecular Formula | C8H21NO3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | dimethyl(propyl)azanium;propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)[O-].CCC[NH+](C)C |
| InChI | InChI=1S/C5H13N.C3H8O3S/c1-4-5-6(2)3;1-2-3-7(4,5)6/h4-5H2,1-3H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | YQRRQZASZVDIJJ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(propyl)azanium;propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(propyl)azanium;propane-1-sulfonate?
The IUPAC name of dimethyl(propyl)azanium;propane-1-sulfonate (CID 87228092) is dimethyl(propyl)azanium;propane-1-sulfonate.
What is the SMILES notation for dimethyl(propyl)azanium;propane-1-sulfonate?
The canonical SMILES for dimethyl(propyl)azanium;propane-1-sulfonate is CCCS(=O)(=O)[O-].CCC[NH+](C)C.
What is the InChIKey of dimethyl(propyl)azanium;propane-1-sulfonate?
The InChIKey is YQRRQZASZVDIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C3H8O3S/c1-4-5-6(2)3;1-2-3-7(4,5)6/h4-5H2,1-3H3;2-3H2,1H3,(H,4,5,6).
What are the key properties of dimethyl(propyl)azanium;propane-1-sulfonate?
dimethyl(propyl)azanium;propane-1-sulfonate has a molecular weight of 211.33 g/mol, XLogP of -0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(propyl)azanium;propane-1-sulfonate is sourced from PubChem (CID 87228092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).