C13H9ClN4O2S — CID 87228724
N-(1,3-benzothiazol-6-ylmethyl)-6-chloro-3-nitropyridin-2-amine (PubChem CID 87228724) has the molecular formula C13H9ClN4O2S and a molecular weight of 320.76 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-ylmethyl)-6-chloro-3-nitropyridin-2-amine.
| Compound Name | N-(1,3-benzothiazol-6-ylmethyl)-6-chloro-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 87228724 |
| Molecular Formula | C13H9ClN4O2S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | N-(1,3-benzothiazol-6-ylmethyl)-6-chloro-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1NCc1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H9ClN4O2S/c14-12-4-3-10(18(19)20)13(17-12)15-6-8-1-2-9-11(5-8)21-7-16-9/h1-5,7H,6H2,(H,15,17) |
| InChIKey | LVMUYSYSVNFDAF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|