C8H15NO4S — CID 87234352
2-methyl-4-(methylcarbamoyl)pent-4-ene-1-sulfonic acid (PubChem CID 87234352) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-methyl-4-(methylcarbamoyl)pent-4-ene-1-sulfonic acid.
| Compound Name | 2-methyl-4-(methylcarbamoyl)pent-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 87234352 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-methyl-4-(methylcarbamoyl)pent-4-ene-1-sulfonic acid |
| SMILES | C=C(CC(C)CS(=O)(=O)O)C(=O)NC |
| InChI | InChI=1S/C8H15NO4S/c1-6(5-14(11,12)13)4-7(2)8(10)9-3/h6H,2,4-5H2,1,3H3,(H,9,10)(H,11,12,13) |
| InChIKey | KKOSDFLHMSHKCM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|