C8H12F3NO — CID 177050353
5,5,5-trifluoro-N,4-dimethyl-2-methylidenepentanamide (PubChem CID 177050353) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is 5,5,5-trifluoro-N,4-dimethyl-2-methylidenepentanamide.
| Compound Name | 5,5,5-trifluoro-N,4-dimethyl-2-methylidenepentanamide |
|---|---|
| PubChem CID | 177050353 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 5,5,5-trifluoro-N,4-dimethyl-2-methylidenepentanamide |
| SMILES | C=C(CC(C)C(F)(F)F)C(=O)NC |
| InChI | InChI=1S/C8H12F3NO/c1-5(7(13)12-3)4-6(2)8(9,10)11/h6H,1,4H2,2-3H3,(H,12,13) |
| InChIKey | TWQOTMGMNOJMJB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|