C20H26F3N5O3 — CID 87234429
(6S,7S)-N-hydroxy-5-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide (PubChem CID 87234429) has the molecular formula C20H26F3N5O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is (6S,7S)-N-hydroxy-5-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide.
| Compound Name | (6S,7S)-N-hydroxy-5-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide |
|---|---|
| PubChem CID | 87234429 |
| Molecular Formula | C20H26F3N5O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (6S,7S)-N-hydroxy-5-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide |
| SMILES | CN1CC2(CC2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H26F3N5O3/c1-26-12-19(4-5-19)11-13(17(29)25-31)15(26)18(30)28-9-7-27(8-10-28)16-14(20(21,22)23)3-2-6-24-16/h2-3,6,13,15,31H,4-5,7-12H2,1H3,(H,25,29)/t13-,15-/m0/s1 |
| InChIKey | RZXHAHNSHFBKBA-ZFWWWQNUSA-N |
| XLogP | 1.35 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|