C20H14BrCl2NO — CID 87237114
3-(4-bromophenyl)-1-(2,6-dichloro-4-pyridinyl)-3-phenylpropan-1-one (PubChem CID 87237114) has the molecular formula C20H14BrCl2NO and a molecular weight of 435.15 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(2,6-dichloro-4-pyridinyl)-3-phenylpropan-1-one.
| Compound Name | 3-(4-bromophenyl)-1-(2,6-dichloro-4-pyridinyl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 87237114 |
| Molecular Formula | C20H14BrCl2NO |
| Molecular Weight | 435.15 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 3-(4-bromophenyl)-1-(2,6-dichloro-4-pyridinyl)-3-phenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccc(Br)cc1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C20H14BrCl2NO/c21-16-8-6-14(7-9-16)17(13-4-2-1-3-5-13)12-18(25)15-10-19(22)24-20(23)11-15/h1-11,17H,12H2 |
| InChIKey | OBAKBIIDVVSJMO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.15 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|