C31H32F6N4 — CID 87239230
(3S)-1-hexyl-N-[4-[7-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methyl]indazol-3-yl]phenyl]pyrrolidin-3-amine (PubChem CID 87239230) has the molecular formula C31H32F6N4 and a molecular weight of 574.61 g/mol. Its IUPAC name is (3S)-1-hexyl-N-[4-[7-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methyl]indazol-3-yl]phenyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-hexyl-N-[4-[7-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methyl]indazol-3-yl]phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 87239230 |
| Molecular Formula | C31H32F6N4 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | (3S)-1-hexyl-N-[4-[7-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methyl]indazol-3-yl]phenyl]pyrrolidin-3-amine |
| SMILES | CCCCCCN1CC[C@H](Nc2ccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3c(F)cc(F)cc3F)cc2)C1 |
| InChI | InChI=1S/C31H32F6N4/c1-2-3-4-5-14-40-15-13-23(18-40)38-22-11-9-20(10-12-22)30-24-7-6-8-26(31(35,36)37)29(24)39-41(30)19-25-27(33)16-21(32)17-28(25)34/h6-12,16-17,23,38H,2-5,13-15,18-19H2,1H3/t23-/m0/s1 |
| InChIKey | XPJIHQQTGYPBFI-QHCPKHFHSA-N |
| XLogP | 8.25 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|