C24H21N3O4S2 — CID 87240684
5-[[4-[2-[methyl-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87240684) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 5-[[4-[2-[methyl-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[methyl-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87240684 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 5-[[4-[2-[methyl-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(CCOc1ccc(C=C2SC(=O)NC2=O)cc1)c1cccnc1OC1=CCC(=S)C=C1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-27(20-3-2-12-25-23(20)31-18-8-10-19(32)11-9-18)13-14-30-17-6-4-16(5-7-17)15-21-22(28)26-24(29)33-21/h2-10,12,15H,11,13-14H2,1H3,(H,26,28,29) |
| InChIKey | VTYPGWQUVJIQDN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|