C12H21O7P — CID 87243424
3-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)heptanoic acid (PubChem CID 87243424) has the molecular formula C12H21O7P and a molecular weight of 308.27 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)heptanoic acid.
| Compound Name | 3-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)heptanoic acid |
|---|---|
| PubChem CID | 87243424 |
| Molecular Formula | C12H21O7P |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)heptanoic acid |
| SMILES | C=C(C)C(=O)OC(CCCC)C(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C12H21O7P/c1-4-5-6-10(19-12(15)8(2)3)9(11(13)14)7-20(16,17)18/h9-10H,2,4-7H2,1,3H3,(H,13,14)(H2,16,17,18) |
| InChIKey | WKXUURITSLLBQK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|