C25H44NO5P — CID 87243640
butan-2-yloxy-[3-[2-(4-octoxyphenyl)morpholin-4-yl]propyl]phosphinic acid (PubChem CID 87243640) has the molecular formula C25H44NO5P and a molecular weight of 469.60 g/mol. Its IUPAC name is butan-2-yloxy-[3-[2-(4-octoxyphenyl)morpholin-4-yl]propyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[3-[2-(4-octoxyphenyl)morpholin-4-yl]propyl]phosphinic acid |
|---|---|
| PubChem CID | 87243640 |
| Molecular Formula | C25H44NO5P |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | butan-2-yloxy-[3-[2-(4-octoxyphenyl)morpholin-4-yl]propyl]phosphinic acid |
| SMILES | CCCCCCCCOc1ccc(C2CN(CCCP(=O)(O)OC(C)CC)CCO2)cc1 |
| InChI | InChI=1S/C25H44NO5P/c1-4-6-7-8-9-10-18-29-24-14-12-23(13-15-24)25-21-26(17-19-30-25)16-11-20-32(27,28)31-22(3)5-2/h12-15,22,25H,4-11,16-21H2,1-3H3,(H,27,28) |
| InChIKey | ZZCNFWYYBKBPJR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|