About (2-fluoroacetyl) benzenecarboperoxoate
(2-fluoroacetyl) benzenecarboperoxoate (PubChem CID 87248345) has the molecular formula C9H7FO4
and a molecular weight of 198.15 g/mol. Its IUPAC name is (2-fluoroacetyl) benzenecarboperoxoate.
Molecular Properties
| Compound Name | (2-fluoroacetyl) benzenecarboperoxoate |
| PubChem CID | 87248345 |
| Molecular Formula | C9H7FO4 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | (2-fluoroacetyl) benzenecarboperoxoate |
| SMILES | O=C(CF)OOC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H7FO4/c10-6-8(11)13-14-9(12)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | BAMOMSJCUBLIPI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoroacetyl) benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoroacetyl) benzenecarboperoxoate?
The IUPAC name of (2-fluoroacetyl) benzenecarboperoxoate (CID 87248345) is (2-fluoroacetyl) benzenecarboperoxoate.
What is the SMILES notation for (2-fluoroacetyl) benzenecarboperoxoate?
The canonical SMILES for (2-fluoroacetyl) benzenecarboperoxoate is O=C(CF)OOC(=O)c1ccccc1.
What is the InChIKey of (2-fluoroacetyl) benzenecarboperoxoate?
The InChIKey is BAMOMSJCUBLIPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO4/c10-6-8(11)13-14-9(12)7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of (2-fluoroacetyl) benzenecarboperoxoate?
(2-fluoroacetyl) benzenecarboperoxoate has a molecular weight of 198.15 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoroacetyl) benzenecarboperoxoate is sourced from PubChem (CID 87248345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).