C12H8ClF3N2OS — CID 87250161
4-chloro-6-methoxy-2-[(2,3,4-trifluorophenyl)methylsulfanyl]pyrimidine (PubChem CID 87250161) has the molecular formula C12H8ClF3N2OS and a molecular weight of 320.72 g/mol. Its IUPAC name is 4-chloro-6-methoxy-2-[(2,3,4-trifluorophenyl)methylsulfanyl]pyrimidine.
| Compound Name | 4-chloro-6-methoxy-2-[(2,3,4-trifluorophenyl)methylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 87250161 |
| Molecular Formula | C12H8ClF3N2OS |
| Molecular Weight | 320.72 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 4-chloro-6-methoxy-2-[(2,3,4-trifluorophenyl)methylsulfanyl]pyrimidine |
| SMILES | COc1cc(Cl)nc(SCc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H8ClF3N2OS/c1-19-9-4-8(13)17-12(18-9)20-5-6-2-3-7(14)11(16)10(6)15/h2-4H,5H2,1H3 |
| InChIKey | SIZBYVPPHKLHDB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|