C20H28F2N6OS2 — CID 143423367
2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxy-N-[4-[3-(methylamino)propyl]piperazin-1-yl]sulfanylpyrimidin-4-amine (PubChem CID 143423367) has the molecular formula C20H28F2N6OS2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxy-N-[4-[3-(methylamino)propyl]piperazin-1-yl]sulfanylpyrimidin-4-amine.
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxy-N-[4-[3-(methylamino)propyl]piperazin-1-yl]sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143423367 |
| Molecular Formula | C20H28F2N6OS2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-6-methoxy-N-[4-[3-(methylamino)propyl]piperazin-1-yl]sulfanylpyrimidin-4-amine |
| SMILES | CNCCCN1CCN(SNc2cc(OC)nc(SCc3cccc(F)c3F)n2)CC1 |
| InChI | InChI=1S/C20H28F2N6OS2/c1-23-7-4-8-27-9-11-28(12-10-27)31-26-17-13-18(29-2)25-20(24-17)30-14-15-5-3-6-16(21)19(15)22/h3,5-6,13,23H,4,7-12,14H2,1-2H3,(H,24,25,26) |
| InChIKey | LYUHFWNQPGARPD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|