C23H28N4O5S3 — CID 87250173
2-[[3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamothioylamino)propanoic acid (PubChem CID 87250173) has the molecular formula C23H28N4O5S3 and a molecular weight of 536.70 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamothioylamino)propanoic acid.
| Compound Name | 2-[[3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamothioylamino)propanoic acid |
|---|---|
| PubChem CID | 87250173 |
| Molecular Formula | C23H28N4O5S3 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 2-[[3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamothioylamino)propanoic acid |
| SMILES | CC1(C)SCN(S(=O)(=O)c2ccccc2)C1C(=O)NC(CNC(=S)NCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H28N4O5S3/c1-23(2)19(27(15-34-23)35(31,32)17-11-7-4-8-12-17)20(28)26-18(21(29)30)14-25-22(33)24-13-16-9-5-3-6-10-16/h3-12,18-19H,13-15H2,1-2H3,(H,26,28)(H,29,30)(H2,24,25,33) |
| InChIKey | AQXPUOGAESAWEQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|