C22H26N4O6S — CID 87256046
N-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]-4-(methanesulfonamido)benzamide (PubChem CID 87256046) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 87256046 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]-4-(methanesulfonamido)benzamide |
| SMILES | CC(C)(C)c1cc(N2CCC(=O)NC2=O)cc(NC(=O)c2ccc(NS(C)(=O)=O)cc2)c1O |
| InChI | InChI=1S/C22H26N4O6S/c1-22(2,3)16-11-15(26-10-9-18(27)24-21(26)30)12-17(19(16)28)23-20(29)13-5-7-14(8-6-13)25-33(4,31)32/h5-8,11-12,25,28H,9-10H2,1-4H3,(H,23,29)(H,24,27,30) |
| InChIKey | YYJKXGFIVUSLFA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|