C25H30N2O6S — CID 58195069
N-[3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-methoxyphenyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 58195069) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-methoxyphenyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-methoxyphenyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 58195069 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-methoxyphenyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | COc1c(NC(=O)c2ccc(CS(C)(=O)=O)cc2)cc(N2CCC(=O)CC2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C25H30N2O6S/c1-25(2,3)20-12-18(27-11-10-19(28)14-22(27)29)13-21(23(20)33-4)26-24(30)17-8-6-16(7-9-17)15-34(5,31)32/h6-9,12-13H,10-11,14-15H2,1-5H3,(H,26,30) |
| InChIKey | NVXSSFFCCWUYHI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|