C27H31N3O7 — CID 67066418
ethyl 3-[4-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxybenzoyl]amino]phenyl]-3-oxopropanoate (PubChem CID 67066418) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is ethyl 3-[4-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxybenzoyl]amino]phenyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxybenzoyl]amino]phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 67066418 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | ethyl 3-[4-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxybenzoyl]amino]phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1ccc(NC(=O)c2cc(N3CCC(=O)NC3=O)cc(C(C)(C)C)c2OC)cc1 |
| InChI | InChI=1S/C27H31N3O7/c1-6-37-23(33)15-21(31)16-7-9-17(10-8-16)28-25(34)19-13-18(30-12-11-22(32)29-26(30)35)14-20(24(19)36-5)27(2,3)4/h7-10,13-14H,6,11-12,15H2,1-5H3,(H,28,34)(H,29,32,35) |
| InChIKey | SJGFKVCMOWSPRB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|