C28H35N4O8S- — CID 90106041
1-[3-tert-butyl-5-[[4-[[2-carboxybutyl(sulfinato)amino]methyl]phenyl]carbamoyl]-4-methoxyphenyl]-2,4-dioxo-1,3-diazinane (PubChem CID 90106041) has the molecular formula C28H35N4O8S- and a molecular weight of 587.68 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-[[4-[[2-carboxybutyl(sulfinato)amino]methyl]phenyl]carbamoyl]-4-methoxyphenyl]-2,4-dioxo-1,3-diazinane.
| Compound Name | 1-[3-tert-butyl-5-[[4-[[2-carboxybutyl(sulfinato)amino]methyl]phenyl]carbamoyl]-4-methoxyphenyl]-2,4-dioxo-1,3-diazinane |
|---|---|
| PubChem CID | 90106041 |
| Molecular Formula | C28H35N4O8S- |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 1-[3-tert-butyl-5-[[4-[[2-carboxybutyl(sulfinato)amino]methyl]phenyl]carbamoyl]-4-methoxyphenyl]-2,4-dioxo-1,3-diazinane |
| SMILES | CCC(CN(Cc1ccc(NC(=O)c2cc(N3CCC(=O)NC3=O)cc(C(C)(C)C)c2OC)cc1)S(=O)[O-])C(=O)O |
| InChI | InChI=1S/C28H36N4O8S/c1-6-18(26(35)36)16-31(41(38)39)15-17-7-9-19(10-8-17)29-25(34)21-13-20(32-12-11-23(33)30-27(32)37)14-22(24(21)40-5)28(2,3)4/h7-10,13-14,18H,6,11-12,15-16H2,1-5H3,(H,29,34)(H,35,36)(H,38,39)(H,30,33,37)/p-1 |
| InChIKey | ZWGITMHGKPKCIF-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|