C26H32N2O7S — CID 58195095
3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-hydroxy-N-[4-(2-methoxyethylsulfonylmethyl)phenyl]benzamide (PubChem CID 58195095) has the molecular formula C26H32N2O7S and a molecular weight of 516.62 g/mol. Its IUPAC name is 3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-hydroxy-N-[4-(2-methoxyethylsulfonylmethyl)phenyl]benzamide.
| Compound Name | 3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-hydroxy-N-[4-(2-methoxyethylsulfonylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58195095 |
| Molecular Formula | C26H32N2O7S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 3-tert-butyl-5-(2,4-dioxopiperidin-1-yl)-2-hydroxy-N-[4-(2-methoxyethylsulfonylmethyl)phenyl]benzamide |
| SMILES | COCCS(=O)(=O)Cc1ccc(NC(=O)c2cc(N3CCC(=O)CC3=O)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C26H32N2O7S/c1-26(2,3)22-14-19(28-10-9-20(29)15-23(28)30)13-21(24(22)31)25(32)27-18-7-5-17(6-8-18)16-36(33,34)12-11-35-4/h5-8,13-14,31H,9-12,15-16H2,1-4H3,(H,27,32) |
| InChIKey | KKZWGPAXCSZXOR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|