C14H18O9 — CID 87259055
4-[1-[1-(3-carboxypropanoyloxy)prop-2-enoxy]prop-2-enoxy]-4-oxobutanoic acid (PubChem CID 87259055) has the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. Its IUPAC name is 4-[1-[1-(3-carboxypropanoyloxy)prop-2-enoxy]prop-2-enoxy]-4-oxobutanoic acid.
| Compound Name | 4-[1-[1-(3-carboxypropanoyloxy)prop-2-enoxy]prop-2-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87259055 |
| Molecular Formula | C14H18O9 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[1-[1-(3-carboxypropanoyloxy)prop-2-enoxy]prop-2-enoxy]-4-oxobutanoic acid |
| SMILES | C=CC(OC(=O)CCC(=O)O)OC(C=C)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H18O9/c1-3-13(21-11(19)7-5-9(15)16)23-14(4-2)22-12(20)8-6-10(17)18/h3-4,13-14H,1-2,5-8H2,(H,15,16)(H,17,18) |
| InChIKey | GJJASQGNHWHFKX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|