C9H20O4S2 — CID 87259989
2,2-bis(ethylsulfonyl)-3-methylbutane (PubChem CID 87259989) has the molecular formula C9H20O4S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,2-bis(ethylsulfonyl)-3-methylbutane.
| Compound Name | 2,2-bis(ethylsulfonyl)-3-methylbutane |
|---|---|
| PubChem CID | 87259989 |
| Molecular Formula | C9H20O4S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2,2-bis(ethylsulfonyl)-3-methylbutane |
| SMILES | CCS(=O)(=O)C(C)(C(C)C)S(=O)(=O)CC |
| InChI | InChI=1S/C9H20O4S2/c1-6-14(10,11)9(5,8(3)4)15(12,13)7-2/h8H,6-7H2,1-5H3 |
| InChIKey | SGJKXBNYFMHIFE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |