C8H22ClNO4S2 — CID 173418492
azane;2,2-bis(ethylsulfonyl)butane;hydrochloride (PubChem CID 173418492) has the molecular formula C8H22ClNO4S2 and a molecular weight of 295.85 g/mol. Its IUPAC name is azane;2,2-bis(ethylsulfonyl)butane;hydrochloride.
| Compound Name | azane;2,2-bis(ethylsulfonyl)butane;hydrochloride |
|---|---|
| PubChem CID | 173418492 |
| Molecular Formula | C8H22ClNO4S2 |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | azane;2,2-bis(ethylsulfonyl)butane;hydrochloride |
| SMILES | CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC.Cl.N |
| InChI | InChI=1S/C8H18O4S2.ClH.H3N/c1-5-8(4,13(9,10)6-2)14(11,12)7-3;;/h5-7H2,1-4H3;1H;1H3 |
| InChIKey | JRHAKBISQNCYOJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |