C21H42N2O9S4 — CID 173390252
bis(2,2-bis(ethylsulfonyl)butane);1,3-dihydro-1,3-diazepin-2-one (PubChem CID 173390252) has the molecular formula C21H42N2O9S4 and a molecular weight of 594.84 g/mol. Its IUPAC name is bis(2,2-bis(ethylsulfonyl)butane);1,3-dihydro-1,3-diazepin-2-one.
| Compound Name | bis(2,2-bis(ethylsulfonyl)butane);1,3-dihydro-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 173390252 |
| Molecular Formula | C21H42N2O9S4 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | bis(2,2-bis(ethylsulfonyl)butane);1,3-dihydro-1,3-diazepin-2-one |
| SMILES | CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC.CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC.O=C1NC=CC=CN1 |
| InChI | InChI=1S/2C8H18O4S2.C5H6N2O/c2*1-5-8(4,13(9,10)6-2)14(11,12)7-3;8-5-6-3-1-2-4-7-5/h2*5-7H2,1-4H3;1-4H,(H2,6,7,8) |
| InChIKey | YOMXCERSNDQFMH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 177.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |