C8H20O7S2Si — CID 88521041
2,2-bis(ethylsulfonyl)butane;dihydroxy(oxo)silane (PubChem CID 88521041) has the molecular formula C8H20O7S2Si and a molecular weight of 320.46 g/mol. Its IUPAC name is 2,2-bis(ethylsulfonyl)butane;dihydroxy(oxo)silane.
| Compound Name | 2,2-bis(ethylsulfonyl)butane;dihydroxy(oxo)silane |
|---|---|
| PubChem CID | 88521041 |
| Molecular Formula | C8H20O7S2Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2,2-bis(ethylsulfonyl)butane;dihydroxy(oxo)silane |
| SMILES | CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC.O=[Si](O)O |
| InChI | InChI=1S/C8H18O4S2.H2O3Si/c1-5-8(4,13(9,10)6-2)14(11,12)7-3;1-4(2)3/h5-7H2,1-4H3;1-2H |
| InChIKey | VROSPUFHDZZSGG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|