C12H30O6 — CID 87266481
ethanol;2-(2-hydroxypropoxy)pentane-1,5-diol (PubChem CID 87266481) has the molecular formula C12H30O6 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethanol;2-(2-hydroxypropoxy)pentane-1,5-diol.
| Compound Name | ethanol;2-(2-hydroxypropoxy)pentane-1,5-diol |
|---|---|
| PubChem CID | 87266481 |
| Molecular Formula | C12H30O6 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | ethanol;2-(2-hydroxypropoxy)pentane-1,5-diol |
| SMILES | CC(O)COC(CO)CCCO.CCO.CCO |
| InChI | InChI=1S/C8H18O4.2C2H6O/c1-7(11)6-12-8(5-10)3-2-4-9;2*1-2-3/h7-11H,2-6H2,1H3;2*3H,2H2,1H3 |
| InChIKey | SAHWOTKKATYDIG-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |