C9H20O5 — CID 171403130
2-(2-hydroxy-3-methoxypropoxy)pentane-1,5-diol (PubChem CID 171403130) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-(2-hydroxy-3-methoxypropoxy)pentane-1,5-diol.
| Compound Name | 2-(2-hydroxy-3-methoxypropoxy)pentane-1,5-diol |
|---|---|
| PubChem CID | 171403130 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(2-hydroxy-3-methoxypropoxy)pentane-1,5-diol |
| SMILES | COCC(O)COC(CO)CCCO |
| InChI | InChI=1S/C9H20O5/c1-13-6-8(12)7-14-9(5-11)3-2-4-10/h8-12H,2-7H2,1H3 |
| InChIKey | KAINUSXBLUDTTC-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |