C8H18N2O3 — CID 87267529
[(2S)-3-aminooxy-4,4-dimethylpentan-2-yl]carbamic acid (PubChem CID 87267529) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is [(2S)-3-aminooxy-4,4-dimethylpentan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-aminooxy-4,4-dimethylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87267529 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | [(2S)-3-aminooxy-4,4-dimethylpentan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)C(ON)C(C)(C)C |
| InChI | InChI=1S/C8H18N2O3/c1-5(10-7(11)12)6(13-9)8(2,3)4/h5-6,10H,9H2,1-4H3,(H,11,12)/t5-,6?/m0/s1 |
| InChIKey | BJXTXECQENVNQC-ZBHICJROSA-N |
| XLogP | 0.95 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|