About 1-aminooxyethylcarbamic acid
1-aminooxyethylcarbamic acid (PubChem CID 87523079) has the molecular formula C3H8N2O3
and a molecular weight of 120.11 g/mol. Its IUPAC name is 1-aminooxyethylcarbamic acid.
Molecular Properties
| Compound Name | 1-aminooxyethylcarbamic acid |
| PubChem CID | 87523079 |
| Molecular Formula | C3H8N2O3 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | 1-aminooxyethylcarbamic acid |
| SMILES | CC(NC(=O)O)ON |
| InChI | InChI=1S/C3H8N2O3/c1-2(8-4)5-3(6)7/h2,5H,4H2,1H3,(H,6,7) |
| InChIKey | VWSQZFVTDDDPHC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminooxyethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminooxyethylcarbamic acid?
The IUPAC name of 1-aminooxyethylcarbamic acid (CID 87523079) is 1-aminooxyethylcarbamic acid.
What is the SMILES notation for 1-aminooxyethylcarbamic acid?
The canonical SMILES for 1-aminooxyethylcarbamic acid is CC(NC(=O)O)ON.
What is the InChIKey of 1-aminooxyethylcarbamic acid?
The InChIKey is VWSQZFVTDDDPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O3/c1-2(8-4)5-3(6)7/h2,5H,4H2,1H3,(H,6,7).
What are the key properties of 1-aminooxyethylcarbamic acid?
1-aminooxyethylcarbamic acid has a molecular weight of 120.11 g/mol, XLogP of -0.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminooxyethylcarbamic acid is sourced from PubChem (CID 87523079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).