C20H22F8O6 — CID 87268876
bis[1,2,2,2-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]ethyl] benzene-1,2-dicarboxylate (PubChem CID 87268876) has the molecular formula C20H22F8O6 and a molecular weight of 510.37 g/mol. Its IUPAC name is bis[1,2,2,2-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]ethyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[1,2,2,2-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87268876 |
| Molecular Formula | C20H22F8O6 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | bis[1,2,2,2-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]ethyl] benzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(F)(OC(=O)c1ccccc1C(=O)OC(F)(OC(C)(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H22F8O6/c1-15(2,3)33-19(27,17(21,22)23)31-13(29)11-9-7-8-10-12(11)14(30)32-20(28,18(24,25)26)34-16(4,5)6/h7-10H,1-6H3 |
| InChIKey | PVASWWKTCBPENJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|