C19H8F6O8-2 — CID 154071132
2-[2-(2-carboxylatobenzoyl)oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]oxycarbonylbenzoate (PubChem CID 154071132) has the molecular formula C19H8F6O8-2 and a molecular weight of 478.25 g/mol. Its IUPAC name is 2-[2-(2-carboxylatobenzoyl)oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]oxycarbonylbenzoate.
| Compound Name | 2-[2-(2-carboxylatobenzoyl)oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]oxycarbonylbenzoate |
|---|---|
| PubChem CID | 154071132 |
| Molecular Formula | C19H8F6O8-2 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 2-[2-(2-carboxylatobenzoyl)oxy-1,1,1,3,3,3-hexafluoropropan-2-yl]oxycarbonylbenzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)OC(OC(=O)c1ccccc1C(=O)[O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H10F6O8/c20-18(21,22)17(19(23,24)25,32-15(30)11-7-3-1-5-9(11)13(26)27)33-16(31)12-8-4-2-6-10(12)14(28)29/h1-8H,(H,26,27)(H,28,29)/p-2 |
| InChIKey | YUFYOHFWUVGWQR-UHFFFAOYSA-L |
| XLogP | 1.25 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|