C30H30F3N5O — CID 87270689
1-cyano-3-[2-[(4R)-1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]ethyl]-2-methylguanidine (PubChem CID 87270689) has the molecular formula C30H30F3N5O and a molecular weight of 533.60 g/mol. Its IUPAC name is 1-cyano-3-[2-[(4R)-1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[2-[(4R)-1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 87270689 |
| Molecular Formula | C30H30F3N5O |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 1-cyano-3-[2-[(4R)-1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCC[C@@]1(c2ccc(F)cc2)CCN([C@@H](C)c2ccc(-c3ccc(F)cc3F)cc2)C(=O)C1 |
| InChI | InChI=1S/C30H30F3N5O/c1-20(21-3-5-22(6-4-21)26-12-11-25(32)17-27(26)33)38-16-14-30(18-28(38)39,23-7-9-24(31)10-8-23)13-15-36-29(35-2)37-19-34/h3-12,17,20H,13-16,18H2,1-2H3,(H2,35,36,37)/t20-,30+/m0/s1 |
| InChIKey | WBDGRKXJFIMYHK-WENCNXQZSA-N |
| XLogP | 5.43 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|