About 1,2-disulfonylethene
1,2-disulfonylethene (PubChem CID 87271735) has the molecular formula C2O4S2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1,2-disulfonylethene.
Molecular Properties
| Compound Name | 1,2-disulfonylethene |
| PubChem CID | 87271735 |
| Molecular Formula | C2O4S2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 151.92 |
| IUPAC Name | 1,2-disulfonylethene |
| SMILES | O=S(=O)=C=C=S(=O)=O |
| InChI | InChI=1S/C2O4S2/c3-7(4)1-2-8(5)6 |
| InChIKey | LDNALYXBKKZPJN-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-disulfonylethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-disulfonylethene?
The IUPAC name of 1,2-disulfonylethene (CID 87271735) is 1,2-disulfonylethene.
What is the SMILES notation for 1,2-disulfonylethene?
The canonical SMILES for 1,2-disulfonylethene is O=S(=O)=C=C=S(=O)=O.
What is the InChIKey of 1,2-disulfonylethene?
The InChIKey is LDNALYXBKKZPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2O4S2/c3-7(4)1-2-8(5)6.
What are the key properties of 1,2-disulfonylethene?
1,2-disulfonylethene has a molecular weight of 152.15 g/mol, XLogP of -1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-disulfonylethene is sourced from PubChem (CID 87271735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).