C36H44Cl6O8 — CID 87273097
bis[3,4,6-trichloro-2-(2-methylnonoxycarbonyl)phenyl] oxalate (PubChem CID 87273097) has the molecular formula C36H44Cl6O8 and a molecular weight of 817.46 g/mol. Its IUPAC name is bis[3,4,6-trichloro-2-(2-methylnonoxycarbonyl)phenyl] oxalate.
| Compound Name | bis[3,4,6-trichloro-2-(2-methylnonoxycarbonyl)phenyl] oxalate |
|---|---|
| PubChem CID | 87273097 |
| Molecular Formula | C36H44Cl6O8 |
| Molecular Weight | 817.46 g/mol |
| Exact Mass | 814.12 |
| IUPAC Name | bis[3,4,6-trichloro-2-(2-methylnonoxycarbonyl)phenyl] oxalate |
| SMILES | CCCCCCCC(C)COC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCC(C)CCCCCCC |
| InChI | InChI=1S/C36H44Cl6O8/c1-5-7-9-11-13-15-21(3)19-47-33(43)27-29(41)23(37)17-25(39)31(27)49-35(45)36(46)50-32-26(40)18-24(38)30(42)28(32)34(44)48-20-22(4)16-14-12-10-8-6-2/h17-18,21-22H,5-16,19-20H2,1-4H3 |
| InChIKey | JRXVGGNUNSMBFS-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.46 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|