C9H9FN2O3 — CID 87274668
[(4-fluorophenyl)methyl-formylamino]carbamic acid (PubChem CID 87274668) has the molecular formula C9H9FN2O3 and a molecular weight of 212.18 g/mol. Its IUPAC name is [(4-fluorophenyl)methyl-formylamino]carbamic acid.
| Compound Name | [(4-fluorophenyl)methyl-formylamino]carbamic acid |
|---|---|
| PubChem CID | 87274668 |
| Molecular Formula | C9H9FN2O3 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | [(4-fluorophenyl)methyl-formylamino]carbamic acid |
| SMILES | O=CN(Cc1ccc(F)cc1)NC(=O)O |
| InChI | InChI=1S/C9H9FN2O3/c10-8-3-1-7(2-4-8)5-12(6-13)11-9(14)15/h1-4,6,11H,5H2,(H,14,15) |
| InChIKey | IJGSFUFYCXIGFR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|