About 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane
1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane (PubChem CID 87274994) has the molecular formula C7H14NO2+
and a molecular weight of 144.19 g/mol. Its IUPAC name is 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane |
| PubChem CID | 87274994 |
| Molecular Formula | C7H14NO2+ |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane |
| SMILES | CCC[N+]12CCOCC1O2 |
| InChI | InChI=1S/C7H14NO2/c1-2-3-8-4-5-9-6-7(8)10-8/h7H,2-6H2,1H3/q+1 |
| InChIKey | OGGUEBDBDWFQIJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane?
The IUPAC name of 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane (CID 87274994) is 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane.
What is the SMILES notation for 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane?
The canonical SMILES for 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane is CCC[N+]12CCOCC1O2.
What is the InChIKey of 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane?
The InChIKey is OGGUEBDBDWFQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO2/c1-2-3-8-4-5-9-6-7(8)10-8/h7H,2-6H2,1H3/q+1.
What are the key properties of 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane?
1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane has a molecular weight of 144.19 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-4,7-dioxa-1-azoniabicyclo[4.1.0]heptane is sourced from PubChem (CID 87274994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).