C17H22F3N3O4S — CID 87275493
1-(cyclopropylmethyl)-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxyurea (PubChem CID 87275493) has the molecular formula C17H22F3N3O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxyurea.
| Compound Name | 1-(cyclopropylmethyl)-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxyurea |
|---|---|
| PubChem CID | 87275493 |
| Molecular Formula | C17H22F3N3O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxyurea |
| SMILES | O=C(NCC1CC1)NOC1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H22F3N3O4S/c18-17(19,20)13-2-1-3-15(10-13)28(25,26)23-8-6-14(7-9-23)27-22-16(24)21-11-12-4-5-12/h1-3,10,12,14H,4-9,11H2,(H2,21,22,24) |
| InChIKey | KFQAURPVHDBRQP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|