C13H11Cl2NO3 — CID 87276958
5-(4-chloro-2-ethoxyphenyl)-4-methyl-1,2-oxazole-3-carbonyl chloride (PubChem CID 87276958) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 5-(4-chloro-2-ethoxyphenyl)-4-methyl-1,2-oxazole-3-carbonyl chloride.
| Compound Name | 5-(4-chloro-2-ethoxyphenyl)-4-methyl-1,2-oxazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 87276958 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 5-(4-chloro-2-ethoxyphenyl)-4-methyl-1,2-oxazole-3-carbonyl chloride |
| SMILES | CCOc1cc(Cl)ccc1-c1onc(C(=O)Cl)c1C |
| InChI | InChI=1S/C13H11Cl2NO3/c1-3-18-10-6-8(14)4-5-9(10)12-7(2)11(13(15)17)16-19-12/h4-6H,3H2,1-2H3 |
| InChIKey | MASNTORXYCKMNB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|