C8H11FN2O2S — CID 87277777
3-(3-fluoropiperidin-4-yl)-1,3-thiazolidine-2,4-dione (PubChem CID 87277777) has the molecular formula C8H11FN2O2S and a molecular weight of 218.25 g/mol. Its IUPAC name is 3-(3-fluoropiperidin-4-yl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(3-fluoropiperidin-4-yl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87277777 |
| Molecular Formula | C8H11FN2O2S |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 3-(3-fluoropiperidin-4-yl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1C1CCNCC1F |
| InChI | InChI=1S/C8H11FN2O2S/c9-5-3-10-2-1-6(5)11-7(12)4-14-8(11)13/h5-6,10H,1-4H2 |
| InChIKey | CEBJKYGYELUJGA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|